C16H24BF3N2O2 — CID 69028649
N'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 69028649) has the molecular formula C16H24BF3N2O2 and a molecular weight of 344.19 g/mol. Its IUPAC name is N'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 69028649 |
| Molecular Formula | C16H24BF3N2O2 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N'-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CC1(C)OB(c2ccc(NCCNCC(F)(F)F)cc2)OC1(C)C |
| InChI | InChI=1S/C16H24BF3N2O2/c1-14(2)15(3,4)24-17(23-14)12-5-7-13(8-6-12)22-10-9-21-11-16(18,19)20/h5-8,21-22H,9-11H2,1-4H3 |
| InChIKey | QHHOHDNYMNXIKI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|