C7H12N2O2 — CID 69029227
(3aR,7aS)-7-methyl-3a,4,5,6,7,7a-hexahydro-3H-[1,3]oxazolo[4,5-c]pyridin-2-one (PubChem CID 69029227) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is (3aR,7aS)-7-methyl-3a,4,5,6,7,7a-hexahydro-3H-[1,3]oxazolo[4,5-c]pyridin-2-one.
| Compound Name | (3aR,7aS)-7-methyl-3a,4,5,6,7,7a-hexahydro-3H-[1,3]oxazolo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 69029227 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (3aR,7aS)-7-methyl-3a,4,5,6,7,7a-hexahydro-3H-[1,3]oxazolo[4,5-c]pyridin-2-one |
| SMILES | CC1CNC[C@H]2NC(=O)O[C@@H]12 |
| InChI | InChI=1S/C7H12N2O2/c1-4-2-8-3-5-6(4)11-7(10)9-5/h4-6,8H,2-3H2,1H3,(H,9,10)/t4?,5-,6+/m1/s1 |
| InChIKey | MJDUEMKRJSRCIB-UVCATTPVSA-N |
| XLogP | -0.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |