C15H22O2 — CID 69029801
1-methyl-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene-9,10-dione (PubChem CID 69029801) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-methyl-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene-9,10-dione.
| Compound Name | 1-methyl-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 69029801 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 1-methyl-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene-9,10-dione |
| SMILES | CC1CCCC2C(=O)C3CCCCC3C(=O)C12 |
| InChI | InChI=1S/C15H22O2/c1-9-5-4-8-12-13(9)15(17)11-7-3-2-6-10(11)14(12)16/h9-13H,2-8H2,1H3 |
| InChIKey | DSNQUSIABJITOZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |