C20H18N6O2 — CID 6903053
(E)-1-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6903053) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is (E)-1-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6903053 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (E)-1-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/n2cnnc2)cc1OC |
| InChI | InChI=1S/C20H18N6O2/c1-27-18-9-8-15(10-19(18)28-2)20-16(11-23-25-13-21-22-14-25)12-26(24-20)17-6-4-3-5-7-17/h3-14H,1-2H3/b23-11+ |
| InChIKey | GZMLPPMEXOFJTH-FOKLQQMPSA-N |
| XLogP | 3.03 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|