About 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine
2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine (PubChem CID 69030660) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine |
| PubChem CID | 69030660 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine |
| SMILES | NCCc1csc(-c2ccn[nH]2)n1 |
| InChI | InChI=1S/C8H10N4S/c9-3-1-6-5-13-8(11-6)7-2-4-10-12-7/h2,4-5H,1,3,9H2,(H,10,12) |
| InChIKey | HUWZZNRXEDQKTK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine?
The IUPAC name of 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine (CID 69030660) is 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine.
What is the SMILES notation for 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine?
The canonical SMILES for 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine is NCCc1csc(-c2ccn[nH]2)n1.
What is the InChIKey of 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine?
The InChIKey is HUWZZNRXEDQKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c9-3-1-6-5-13-8(11-6)7-2-4-10-12-7/h2,4-5H,1,3,9H2,(H,10,12).
What are the key properties of 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine?
2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine has a molecular weight of 194.26 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1H-pyrazol-5-yl)-1,3-thiazol-4-yl]ethanamine is sourced from PubChem (CID 69030660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).