About (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine
(E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 6903079) has the molecular formula C16H14FN3OS
and a molecular weight of 315.37 g/mol. Its IUPAC name is (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| PubChem CID | 6903079 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(F)cc2)n1/N=C/c1ccc(C)o1 |
| InChI | InChI=1S/C16H14FN3OS/c1-11-3-8-14(21-11)9-19-20-15(10-22-16(20)18-2)12-4-6-13(17)7-5-12/h3-10H,1-2H3/b18-16-,19-9+ |
| InChIKey | IIUUVLDWOXAMJP-BMOFTDQESA-N |
| XLogP | 3.67 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine?
The IUPAC name of (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine (CID 6903079) is (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine.
What is the SMILES notation for (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine?
The canonical SMILES for (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine is C/N=c1\scc(-c2ccc(F)cc2)n1/N=C/c1ccc(C)o1.
What is the InChIKey of (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine?
The InChIKey is IIUUVLDWOXAMJP-BMOFTDQESA-N. The full InChI is InChI=1S/C16H14FN3OS/c1-11-3-8-14(21-11)9-19-20-15(10-22-16(20)18-2)12-4-6-13(17)7-5-12/h3-10H,1-2H3/b18-16-,19-9+.
What are the key properties of (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine?
(E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine has a molecular weight of 315.37 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(4-fluorophenyl)-N-methyl-3-[(E)-(5-methylfuran-2-yl)methylideneamino]-1,3-thiazol-2-imine is sourced from PubChem (CID 6903079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).