C24H22F2N8 — CID 69031089
3-[4-(2,3-difluorophenyl)-1,2,4-triazol-3-yl]-5-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]pyrazin-2-amine (PubChem CID 69031089) has the molecular formula C24H22F2N8 and a molecular weight of 460.49 g/mol. Its IUPAC name is 3-[4-(2,3-difluorophenyl)-1,2,4-triazol-3-yl]-5-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]pyrazin-2-amine.
| Compound Name | 3-[4-(2,3-difluorophenyl)-1,2,4-triazol-3-yl]-5-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 69031089 |
| Molecular Formula | C24H22F2N8 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 3-[4-(2,3-difluorophenyl)-1,2,4-triazol-3-yl]-5-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]pyrazin-2-amine |
| SMILES | CN1C[C@@H]2C[C@H]1CN2c1ccc(-c2cnc(N)c(-c3nncn3-c3cccc(F)c3F)n2)cc1 |
| InChI | InChI=1S/C24H22F2N8/c1-32-11-17-9-16(32)12-33(17)15-7-5-14(6-8-15)19-10-28-23(27)22(30-19)24-31-29-13-34(24)20-4-2-3-18(25)21(20)26/h2-8,10,13,16-17H,9,11-12H2,1H3,(H2,27,28)/t16-,17-/m0/s1 |
| InChIKey | GZDRWQIURXSFCK-IRXDYDNUSA-N |
| XLogP | 3.14 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |