About 1,5-dibutyltetrazole
1,5-dibutyltetrazole (PubChem CID 69031174) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 1,5-dibutyltetrazole.
Molecular Properties
| Compound Name | 1,5-dibutyltetrazole |
| PubChem CID | 69031174 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 1,5-dibutyltetrazole |
| SMILES | CCCCc1nnnn1CCCC |
| InChI | InChI=1S/C9H18N4/c1-3-5-7-9-10-11-12-13(9)8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | HGFBELITPGRAMC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dibutyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dibutyltetrazole?
The IUPAC name of 1,5-dibutyltetrazole (CID 69031174) is 1,5-dibutyltetrazole.
What is the SMILES notation for 1,5-dibutyltetrazole?
The canonical SMILES for 1,5-dibutyltetrazole is CCCCc1nnnn1CCCC.
What is the InChIKey of 1,5-dibutyltetrazole?
The InChIKey is HGFBELITPGRAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-3-5-7-9-10-11-12-13(9)8-6-4-2/h3-8H2,1-2H3.
What are the key properties of 1,5-dibutyltetrazole?
1,5-dibutyltetrazole has a molecular weight of 182.27 g/mol, XLogP of 1.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dibutyltetrazole is sourced from PubChem (CID 69031174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).