About 2-iodo-5-nitrotetrazole
2-iodo-5-nitrotetrazole (PubChem CID 69031764) has the molecular formula CIN5O2
and a molecular weight of 240.95 g/mol. Its IUPAC name is 2-iodo-5-nitrotetrazole.
Molecular Properties
| Compound Name | 2-iodo-5-nitrotetrazole |
| PubChem CID | 69031764 |
| Molecular Formula | CIN5O2 |
| Molecular Weight | 240.95 g/mol |
| Exact Mass | 240.91 |
| IUPAC Name | 2-iodo-5-nitrotetrazole |
| SMILES | O=[N+]([O-])c1nnn(I)n1 |
| InChI | InChI=1S/CIN5O2/c2-7-4-1(3-5-7)6(8)9 |
| InChIKey | STTXJVNOTRHJJD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.95 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-5-nitrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-5-nitrotetrazole?
The IUPAC name of 2-iodo-5-nitrotetrazole (CID 69031764) is 2-iodo-5-nitrotetrazole.
What is the SMILES notation for 2-iodo-5-nitrotetrazole?
The canonical SMILES for 2-iodo-5-nitrotetrazole is O=[N+]([O-])c1nnn(I)n1.
What is the InChIKey of 2-iodo-5-nitrotetrazole?
The InChIKey is STTXJVNOTRHJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/CIN5O2/c2-7-4-1(3-5-7)6(8)9.
What are the key properties of 2-iodo-5-nitrotetrazole?
2-iodo-5-nitrotetrazole has a molecular weight of 240.95 g/mol, XLogP of -0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-5-nitrotetrazole is sourced from PubChem (CID 69031764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).