About [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol
[(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol (PubChem CID 69031978) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol.
Molecular Properties
| Compound Name | [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol |
| PubChem CID | 69031978 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol |
| SMILES | Nc1c(NCO)nn2ccccc12 |
| InChI | InChI=1S/C8H10N4O/c9-7-6-3-1-2-4-12(6)11-8(7)10-5-13/h1-4,13H,5,9H2,(H,10,11) |
| InChIKey | BZCWSAIBYPEHRQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol?
The IUPAC name of [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol (CID 69031978) is [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol.
What is the SMILES notation for [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol?
The canonical SMILES for [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol is Nc1c(NCO)nn2ccccc12.
What is the InChIKey of [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol?
The InChIKey is BZCWSAIBYPEHRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c9-7-6-3-1-2-4-12(6)11-8(7)10-5-13/h1-4,13H,5,9H2,(H,10,11).
What are the key properties of [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol?
[(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol has a molecular weight of 178.19 g/mol, XLogP of 0.28, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-aminopyrazolo[1,5-a]pyridin-2-yl)amino]methanol is sourced from PubChem (CID 69031978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).