C10H16N6O5 — CID 69031990
3-[3-(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanehydrazide (PubChem CID 69031990) has the molecular formula C10H16N6O5 and a molecular weight of 300.28 g/mol. Its IUPAC name is 3-[3-(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanehydrazide.
| Compound Name | 3-[3-(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 69031990 |
| Molecular Formula | C10H16N6O5 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-[3-(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3-diazinan-1-yl]propanehydrazide |
| SMILES | NNC(=O)CCN1C(=O)CC(=O)N(CCC(=O)NN)C1=O |
| InChI | InChI=1S/C10H16N6O5/c11-13-6(17)1-3-15-8(19)5-9(20)16(10(15)21)4-2-7(18)14-12/h1-5,11-12H2,(H,13,17)(H,14,18) |
| InChIKey | CAMNHHHAYJPQFL-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 167.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|