C13H16ClN3O4S2 — CID 69032014
5-chloro-2-[2-[(2-ethoxy-2-oxoethyl)amino]ethyl-sulfinoamino]-1,3-benzothiazole (PubChem CID 69032014) has the molecular formula C13H16ClN3O4S2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 5-chloro-2-[2-[(2-ethoxy-2-oxoethyl)amino]ethyl-sulfinoamino]-1,3-benzothiazole.
| Compound Name | 5-chloro-2-[2-[(2-ethoxy-2-oxoethyl)amino]ethyl-sulfinoamino]-1,3-benzothiazole |
|---|---|
| PubChem CID | 69032014 |
| Molecular Formula | C13H16ClN3O4S2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 5-chloro-2-[2-[(2-ethoxy-2-oxoethyl)amino]ethyl-sulfinoamino]-1,3-benzothiazole |
| SMILES | CCOC(=O)CNCCN(c1nc2cc(Cl)ccc2s1)S(=O)O |
| InChI | InChI=1S/C13H16ClN3O4S2/c1-2-21-12(18)8-15-5-6-17(23(19)20)13-16-10-7-9(14)3-4-11(10)22-13/h3-4,7,15H,2,5-6,8H2,1H3,(H,19,20) |
| InChIKey | KMQRKWGBYZRLLA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|