About 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid
2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid (PubChem CID 69032341) has the molecular formula C19H20N4O4
and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid |
| PubChem CID | 69032341 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid |
| SMILES | Cc1cc(-c2cnc3[nH]c(=O)n(CC4CCOCC4)c3n2)ccc1C(=O)O |
| InChI | InChI=1S/C19H20N4O4/c1-11-8-13(2-3-14(11)18(24)25)15-9-20-16-17(21-15)23(19(26)22-16)10-12-4-6-27-7-5-12/h2-3,8-9,12H,4-7,10H2,1H3,(H,24,25)(H,20,22,26) |
| InChIKey | NYCZUDKCDMWADR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid?
The IUPAC name of 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid (CID 69032341) is 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid.
What is the SMILES notation for 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid?
The canonical SMILES for 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid is Cc1cc(-c2cnc3[nH]c(=O)n(CC4CCOCC4)c3n2)ccc1C(=O)O.
What is the InChIKey of 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid?
The InChIKey is NYCZUDKCDMWADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O4/c1-11-8-13(2-3-14(11)18(24)25)15-9-20-16-17(21-15)23(19(26)22-16)10-12-4-6-27-7-5-12/h2-3,8-9,12H,4-7,10H2,1H3,(H,24,25)(H,20,22,26).
What are the key properties of 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid?
2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid has a molecular weight of 368.39 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[3-(oxan-4-ylmethyl)-2-oxo-1H-imidazo[4,5-b]pyrazin-5-yl]benzoic acid is sourced from PubChem (CID 69032341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).