C12H10Cl3N3O2 — CID 69032482
2-(3,5-dimethoxyphenyl)-4-(trichloromethyl)-1,3,5-triazine (PubChem CID 69032482) has the molecular formula C12H10Cl3N3O2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-4-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(3,5-dimethoxyphenyl)-4-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 69032482 |
| Molecular Formula | C12H10Cl3N3O2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-4-(trichloromethyl)-1,3,5-triazine |
| SMILES | COc1cc(OC)cc(-c2ncnc(C(Cl)(Cl)Cl)n2)c1 |
| InChI | InChI=1S/C12H10Cl3N3O2/c1-19-8-3-7(4-9(5-8)20-2)10-16-6-17-11(18-10)12(13,14)15/h3-6H,1-2H3 |
| InChIKey | JWLNEFUDYIIJIF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|