About (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one
(4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one (PubChem CID 69032536) has the molecular formula C6H7F2NO
and a molecular weight of 147.12 g/mol. Its IUPAC name is (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one |
| PubChem CID | 69032536 |
| Molecular Formula | C6H7F2NO |
| Molecular Weight | 147.12 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one |
| SMILES | O=C1C[C@H](C(F)=CF)CN1 |
| InChI | InChI=1S/C6H7F2NO/c7-2-5(8)4-1-6(10)9-3-4/h2,4H,1,3H2,(H,9,10)/t4-/m0/s1 |
| InChIKey | RYRWUTZVYDUWQG-BYPYZUCNSA-N |
| XLogP | 0.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one?
The IUPAC name of (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one (CID 69032536) is (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one.
What is the SMILES notation for (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one?
The canonical SMILES for (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one is O=C1C[C@H](C(F)=CF)CN1.
What is the InChIKey of (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one?
The InChIKey is RYRWUTZVYDUWQG-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H7F2NO/c7-2-5(8)4-1-6(10)9-3-4/h2,4H,1,3H2,(H,9,10)/t4-/m0/s1.
What are the key properties of (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one?
(4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one has a molecular weight of 147.12 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(1,2-difluoroethenyl)pyrrolidin-2-one is sourced from PubChem (CID 69032536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).