C25H24BrFN6O2 — CID 69032844
[6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-[3-(dimethylamino)propyl]carbamate (PubChem CID 69032844) has the molecular formula C25H24BrFN6O2 and a molecular weight of 539.41 g/mol. Its IUPAC name is [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-[3-(dimethylamino)propyl]carbamate.
| Compound Name | [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-[3-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 69032844 |
| Molecular Formula | C25H24BrFN6O2 |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | [6-(2-bromophenyl)-2-(4-fluoroanilino)pyrido[2,3-d]pyrimidin-7-yl] N-[3-(dimethylamino)propyl]carbamate |
| SMILES | CN(C)CCCNC(=O)Oc1nc2nc(Nc3ccc(F)cc3)ncc2cc1-c1ccccc1Br |
| InChI | InChI=1S/C25H24BrFN6O2/c1-33(2)13-5-12-28-25(34)35-23-20(19-6-3-4-7-21(19)26)14-16-15-29-24(32-22(16)31-23)30-18-10-8-17(27)9-11-18/h3-4,6-11,14-15H,5,12-13H2,1-2H3,(H,28,34)(H,29,30,31,32) |
| InChIKey | KTYHLSPWNIUXTF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|