C16H19K2N3O3S — CID 69032906
dipotassium;6-(4-aminocyclohexyl)sulfanylisoquinolin-1-amine;carbonate (PubChem CID 69032906) has the molecular formula C16H19K2N3O3S and a molecular weight of 411.61 g/mol. Its IUPAC name is dipotassium;6-(4-aminocyclohexyl)sulfanylisoquinolin-1-amine;carbonate.
| Compound Name | dipotassium;6-(4-aminocyclohexyl)sulfanylisoquinolin-1-amine;carbonate |
|---|---|
| PubChem CID | 69032906 |
| Molecular Formula | C16H19K2N3O3S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | dipotassium;6-(4-aminocyclohexyl)sulfanylisoquinolin-1-amine;carbonate |
| SMILES | Nc1nccc2cc(SC3CCC(N)CC3)ccc12.O=C([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C15H19N3S.CH2O3.2K/c16-11-1-3-12(4-2-11)19-13-5-6-14-10(9-13)7-8-18-15(14)17;2-1(3)4;;/h5-9,11-12H,1-4,16H2,(H2,17,18);(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | IJMNPTICXFJVST-UHFFFAOYSA-L |
| XLogP | -5.26 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |