C42H48F3N5O8 — CID 69033094
3-[[(2S)-6-(phenylmethoxycarbonylamino)-2-[6-(pyridin-2-ylamino)hexanoylamino]hexanoyl]amino]-3-(4-phenylphenyl)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69033094) has the molecular formula C42H48F3N5O8 and a molecular weight of 807.87 g/mol. Its IUPAC name is 3-[[(2S)-6-(phenylmethoxycarbonylamino)-2-[6-(pyridin-2-ylamino)hexanoylamino]hexanoyl]amino]-3-(4-phenylphenyl)propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(2S)-6-(phenylmethoxycarbonylamino)-2-[6-(pyridin-2-ylamino)hexanoylamino]hexanoyl]amino]-3-(4-phenylphenyl)propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69033094 |
| Molecular Formula | C42H48F3N5O8 |
| Molecular Weight | 807.87 g/mol |
| Exact Mass | 807.35 |
| IUPAC Name | 3-[[(2S)-6-(phenylmethoxycarbonylamino)-2-[6-(pyridin-2-ylamino)hexanoylamino]hexanoyl]amino]-3-(4-phenylphenyl)propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CC(NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)CCCCCNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H47N5O6.C2HF3O2/c46-37(20-8-3-11-25-41-36-19-10-13-26-42-36)44-34(18-9-12-27-43-40(50)51-29-30-14-4-1-5-15-30)39(49)45-35(28-38(47)48)33-23-21-32(22-24-33)31-16-6-2-7-17-31;3-2(4,5)1(6)7/h1-2,4-7,10,13-17,19,21-24,26,34-35H,3,8-9,11-12,18,20,25,27-29H2,(H,41,42)(H,43,50)(H,44,46)(H,45,49)(H,47,48);(H,6,7)/t34-,35?;/m0./s1 |
| InChIKey | BPCYDMZWWJILOI-YDOMLMHESA-N |
| XLogP | 7.27 |
| TPSA | 196.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.87 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|