C26H32F3N3 — CID 69033122
(2S)-3-[(3R)-2-(5-cyclopropylpentyl)-5-(2,5-difluorophenyl)-3-phenyl-4H-pyrazol-3-yl]-2-fluoropropan-1-amine (PubChem CID 69033122) has the molecular formula C26H32F3N3 and a molecular weight of 443.56 g/mol. Its IUPAC name is (2S)-3-[(3R)-2-(5-cyclopropylpentyl)-5-(2,5-difluorophenyl)-3-phenyl-4H-pyrazol-3-yl]-2-fluoropropan-1-amine.
| Compound Name | (2S)-3-[(3R)-2-(5-cyclopropylpentyl)-5-(2,5-difluorophenyl)-3-phenyl-4H-pyrazol-3-yl]-2-fluoropropan-1-amine |
|---|---|
| PubChem CID | 69033122 |
| Molecular Formula | C26H32F3N3 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (2S)-3-[(3R)-2-(5-cyclopropylpentyl)-5-(2,5-difluorophenyl)-3-phenyl-4H-pyrazol-3-yl]-2-fluoropropan-1-amine |
| SMILES | NC[C@@H](F)C[C@@]1(c2ccccc2)CC(c2cc(F)ccc2F)=NN1CCCCCC1CC1 |
| InChI | InChI=1S/C26H32F3N3/c27-21-12-13-24(29)23(15-21)25-17-26(16-22(28)18-30,20-8-4-1-5-9-20)32(31-25)14-6-2-3-7-19-10-11-19/h1,4-5,8-9,12-13,15,19,22H,2-3,6-7,10-11,14,16-18,30H2/t22-,26-/m0/s1 |
| InChIKey | PBUYSYPCCFKKSW-NVQXNPDNSA-N |
| XLogP | 5.93 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|