About methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate
methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate (PubChem CID 69034348) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate |
| PubChem CID | 69034348 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate |
| SMILES | COC(=O)c1cc(N)c2c([nH]c3ncc(C)cc32)c1C |
| InChI | InChI=1S/C15H15N3O2/c1-7-4-10-12-11(16)5-9(15(19)20-3)8(2)13(12)18-14(10)17-6-7/h4-6H,16H2,1-3H3,(H,17,18) |
| InChIKey | JNQDPBLNJLMOIA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate?
The IUPAC name of methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate (CID 69034348) is methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate.
What is the SMILES notation for methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate?
The canonical SMILES for methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate is COC(=O)c1cc(N)c2c([nH]c3ncc(C)cc32)c1C.
What is the InChIKey of methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate?
The InChIKey is JNQDPBLNJLMOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-7-4-10-12-11(16)5-9(15(19)20-3)8(2)13(12)18-14(10)17-6-7/h4-6H,16H2,1-3H3,(H,17,18).
What are the key properties of methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate?
methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate has a molecular weight of 269.30 g/mol, XLogP of 2.70, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-3,8-dimethyl-9H-pyrido[2,3-b]indole-7-carboxylate is sourced from PubChem (CID 69034348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).