C10H10O3S — CID 69034613
2-cyclohexa-1,3-dien-1-yl-1,4-oxathiine 4,4-dioxide (PubChem CID 69034613) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-1,4-oxathiine 4,4-dioxide.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-1,4-oxathiine 4,4-dioxide |
|---|---|
| PubChem CID | 69034613 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-1,4-oxathiine 4,4-dioxide |
| SMILES | O=S1(=O)C=COC(C2=CC=CCC2)=C1 |
| InChI | InChI=1S/C10H10O3S/c11-14(12)7-6-13-10(8-14)9-4-2-1-3-5-9/h1-2,4,6-8H,3,5H2 |
| InChIKey | RJWJECPRANLYBD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |