About diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride
diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride (PubChem CID 69034724) has the molecular formula C10H18ClNO4
and a molecular weight of 251.71 g/mol. Its IUPAC name is diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride.
Molecular Properties
| Compound Name | diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride |
| PubChem CID | 69034724 |
| Molecular Formula | C10H18ClNO4 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@H]1CC[C@H](C(=O)OCC)N1.Cl |
| InChI | InChI=1S/C10H17NO4.ClH/c1-3-14-9(12)7-5-6-8(11-7)10(13)15-4-2;/h7-8,11H,3-6H2,1-2H3;1H/t7-,8-;/m1./s1 |
| InChIKey | IAUFBLCQRNNJLX-SCLLHFNJSA-N |
| XLogP | 0.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride?
The IUPAC name of diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride (CID 69034724) is diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride.
What is the SMILES notation for diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride?
The canonical SMILES for diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride is CCOC(=O)[C@H]1CC[C@H](C(=O)OCC)N1.Cl.
What is the InChIKey of diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride?
The InChIKey is IAUFBLCQRNNJLX-SCLLHFNJSA-N. The full InChI is InChI=1S/C10H17NO4.ClH/c1-3-14-9(12)7-5-6-8(11-7)10(13)15-4-2;/h7-8,11H,3-6H2,1-2H3;1H/t7-,8-;/m1./s1.
What are the key properties of diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride?
diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride has a molecular weight of 251.71 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride is sourced from PubChem (CID 69034724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).