About 1,2-dimethylpiperidine;formamide
1,2-dimethylpiperidine;formamide (PubChem CID 69034748) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is 1,2-dimethylpiperidine;formamide.
Molecular Properties
| Compound Name | 1,2-dimethylpiperidine;formamide |
| PubChem CID | 69034748 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1,2-dimethylpiperidine;formamide |
| SMILES | CC1CCCCN1C.NC=O |
| InChI | InChI=1S/C7H15N.CH3NO/c1-7-5-3-4-6-8(7)2;2-1-3/h7H,3-6H2,1-2H3;1H,(H2,2,3) |
| InChIKey | PKXQFXKHEADKQU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylpiperidine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpiperidine;formamide?
The IUPAC name of 1,2-dimethylpiperidine;formamide (CID 69034748) is 1,2-dimethylpiperidine;formamide.
What is the SMILES notation for 1,2-dimethylpiperidine;formamide?
The canonical SMILES for 1,2-dimethylpiperidine;formamide is CC1CCCCN1C.NC=O.
What is the InChIKey of 1,2-dimethylpiperidine;formamide?
The InChIKey is PKXQFXKHEADKQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.CH3NO/c1-7-5-3-4-6-8(7)2;2-1-3/h7H,3-6H2,1-2H3;1H,(H2,2,3).
What are the key properties of 1,2-dimethylpiperidine;formamide?
1,2-dimethylpiperidine;formamide has a molecular weight of 158.25 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpiperidine;formamide is sourced from PubChem (CID 69034748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).