About 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-)
1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-) (PubChem CID 69035349) has the molecular formula C6H9Cl4FeN2
and a molecular weight of 306.81 g/mol. Its IUPAC name is 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-).
Molecular Properties
| Compound Name | 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-) |
| PubChem CID | 69035349 |
| Molecular Formula | C6H9Cl4FeN2 |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 304.89 |
| IUPAC Name | 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-) |
| SMILES | C=CC[NH+]1C=CN=C1.Cl[Fe-](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8N2.4ClH.Fe/c1-2-4-8-5-3-7-6-8;;;;;/h2-3,5-6H,1,4H2;4*1H;/q;;;;;+3/p-3 |
| InChIKey | JFMNHFPDNSRROB-UHFFFAOYSA-K |
| XLogP | 2.33 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-)?
The IUPAC name of 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-) (CID 69035349) is 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-).
What is the SMILES notation for 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-)?
The canonical SMILES for 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-) is C=CC[NH+]1C=CN=C1.Cl[Fe-](Cl)(Cl)Cl.
What is the InChIKey of 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-)?
The InChIKey is JFMNHFPDNSRROB-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H8N2.4ClH.Fe/c1-2-4-8-5-3-7-6-8;;;;;/h2-3,5-6H,1,4H2;4*1H;/q;;;;;+3/p-3.
What are the key properties of 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-)?
1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-) has a molecular weight of 306.81 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-1H-imidazol-1-ium;tetrachloroiron(1-) is sourced from PubChem (CID 69035349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).