About 7-aminothieno[3,2-e][1]benzothiol-2-ol
7-aminothieno[3,2-e][1]benzothiol-2-ol (PubChem CID 69035510) has the molecular formula C10H7NOS2
and a molecular weight of 221.31 g/mol. Its IUPAC name is 7-aminothieno[3,2-e][1]benzothiol-2-ol.
Molecular Properties
| Compound Name | 7-aminothieno[3,2-e][1]benzothiol-2-ol |
| PubChem CID | 69035510 |
| Molecular Formula | C10H7NOS2 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | 7-aminothieno[3,2-e][1]benzothiol-2-ol |
| SMILES | Nc1cc2c(ccc3sc(O)cc32)s1 |
| InChI | InChI=1S/C10H7NOS2/c11-9-3-5-6-4-10(12)14-8(6)2-1-7(5)13-9/h1-4,12H,11H2 |
| InChIKey | JXNCFLCDKWMAPH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-aminothieno[3,2-e][1]benzothiol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminothieno[3,2-e][1]benzothiol-2-ol?
The IUPAC name of 7-aminothieno[3,2-e][1]benzothiol-2-ol (CID 69035510) is 7-aminothieno[3,2-e][1]benzothiol-2-ol.
What is the SMILES notation for 7-aminothieno[3,2-e][1]benzothiol-2-ol?
The canonical SMILES for 7-aminothieno[3,2-e][1]benzothiol-2-ol is Nc1cc2c(ccc3sc(O)cc32)s1.
What is the InChIKey of 7-aminothieno[3,2-e][1]benzothiol-2-ol?
The InChIKey is JXNCFLCDKWMAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NOS2/c11-9-3-5-6-4-10(12)14-8(6)2-1-7(5)13-9/h1-4,12H,11H2.
What are the key properties of 7-aminothieno[3,2-e][1]benzothiol-2-ol?
7-aminothieno[3,2-e][1]benzothiol-2-ol has a molecular weight of 221.31 g/mol, XLogP of 3.40, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminothieno[3,2-e][1]benzothiol-2-ol is sourced from PubChem (CID 69035510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).