About benzotriazol-2-yl benzoate
benzotriazol-2-yl benzoate (PubChem CID 69035511) has the molecular formula C13H9N3O2
and a molecular weight of 239.23 g/mol. Its IUPAC name is benzotriazol-2-yl benzoate.
Molecular Properties
| Compound Name | benzotriazol-2-yl benzoate |
| PubChem CID | 69035511 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | benzotriazol-2-yl benzoate |
| SMILES | O=C(On1nc2ccccc2n1)c1ccccc1 |
| InChI | InChI=1S/C13H9N3O2/c17-13(10-6-2-1-3-7-10)18-16-14-11-8-4-5-9-12(11)15-16/h1-9H |
| InChIKey | FHPGPUNLZZJXMN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzotriazol-2-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-2-yl benzoate?
The IUPAC name of benzotriazol-2-yl benzoate (CID 69035511) is benzotriazol-2-yl benzoate.
What is the SMILES notation for benzotriazol-2-yl benzoate?
The canonical SMILES for benzotriazol-2-yl benzoate is O=C(On1nc2ccccc2n1)c1ccccc1.
What is the InChIKey of benzotriazol-2-yl benzoate?
The InChIKey is FHPGPUNLZZJXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2/c17-13(10-6-2-1-3-7-10)18-16-14-11-8-4-5-9-12(11)15-16/h1-9H.
What are the key properties of benzotriazol-2-yl benzoate?
benzotriazol-2-yl benzoate has a molecular weight of 239.23 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-2-yl benzoate is sourced from PubChem (CID 69035511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).