C27H34F3N3 — CID 69035876
(2S)-3-[(3R)-2-(5-cyclobutylpentyl)-5-(2,5-difluorophenyl)-3-phenyl-4H-pyrazol-3-yl]-2-fluoropropan-1-amine (PubChem CID 69035876) has the molecular formula C27H34F3N3 and a molecular weight of 457.58 g/mol. Its IUPAC name is (2S)-3-[(3R)-2-(5-cyclobutylpentyl)-5-(2,5-difluorophenyl)-3-phenyl-4H-pyrazol-3-yl]-2-fluoropropan-1-amine.
| Compound Name | (2S)-3-[(3R)-2-(5-cyclobutylpentyl)-5-(2,5-difluorophenyl)-3-phenyl-4H-pyrazol-3-yl]-2-fluoropropan-1-amine |
|---|---|
| PubChem CID | 69035876 |
| Molecular Formula | C27H34F3N3 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | (2S)-3-[(3R)-2-(5-cyclobutylpentyl)-5-(2,5-difluorophenyl)-3-phenyl-4H-pyrazol-3-yl]-2-fluoropropan-1-amine |
| SMILES | NC[C@@H](F)C[C@@]1(c2ccccc2)CC(c2cc(F)ccc2F)=NN1CCCCCC1CCC1 |
| InChI | InChI=1S/C27H34F3N3/c28-22-13-14-25(30)24(16-22)26-18-27(17-23(29)19-31,21-11-4-1-5-12-21)33(32-26)15-6-2-3-8-20-9-7-10-20/h1,4-5,11-14,16,20,23H,2-3,6-10,15,17-19,31H2/t23-,27-/m0/s1 |
| InChIKey | ARPNMGXXUAVZLQ-HOFKKMOUSA-N |
| XLogP | 6.32 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|