C11H21N3O — CID 69036426
4-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)butan-1-ol (PubChem CID 69036426) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)butan-1-ol.
| Compound Name | 4-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 69036426 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 4-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)butan-1-ol |
| SMILES | OCCCCN1CCCN2CCCN=C12 |
| InChI | InChI=1S/C11H21N3O/c15-10-2-1-6-13-8-4-9-14-7-3-5-12-11(13)14/h15H,1-10H2 |
| InChIKey | QMQGOPCBEUSXFK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|