About 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene
1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene (PubChem CID 69036753) has the molecular formula C9H8ClF3O2S
and a molecular weight of 272.68 g/mol. Its IUPAC name is 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene.
Molecular Properties
| Compound Name | 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene |
| PubChem CID | 69036753 |
| Molecular Formula | C9H8ClF3O2S |
| Molecular Weight | 272.68 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene |
| SMILES | O=S(=O)(CCCCl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H8ClF3O2S/c10-4-1-5-16(14,15)7-3-2-6(11)8(12)9(7)13/h2-3H,1,4-5H2 |
| InChIKey | JHUSBMLXCHHOGV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene?
The IUPAC name of 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene (CID 69036753) is 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene.
What is the SMILES notation for 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene?
The canonical SMILES for 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene is O=S(=O)(CCCCl)c1ccc(F)c(F)c1F.
What is the InChIKey of 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene?
The InChIKey is JHUSBMLXCHHOGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF3O2S/c10-4-1-5-16(14,15)7-3-2-6(11)8(12)9(7)13/h2-3H,1,4-5H2.
What are the key properties of 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene?
1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene has a molecular weight of 272.68 g/mol, XLogP of 2.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropylsulfonyl)-2,3,4-trifluorobenzene is sourced from PubChem (CID 69036753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).