About thieno[3,2-e][1]benzothiole-2,7-diamine
thieno[3,2-e][1]benzothiole-2,7-diamine (PubChem CID 69036958) has the molecular formula C10H8N2S2
and a molecular weight of 220.32 g/mol. Its IUPAC name is thieno[3,2-e][1]benzothiole-2,7-diamine.
Molecular Properties
| Compound Name | thieno[3,2-e][1]benzothiole-2,7-diamine |
| PubChem CID | 69036958 |
| Molecular Formula | C10H8N2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | thieno[3,2-e][1]benzothiole-2,7-diamine |
| SMILES | Nc1cc2c(ccc3sc(N)cc32)s1 |
| InChI | InChI=1S/C10H8N2S2/c11-9-3-5-6-4-10(12)14-8(6)2-1-7(5)13-9/h1-4H,11-12H2 |
| InChIKey | RRMBQOPOIKHNOJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[3,2-e][1]benzothiole-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-e][1]benzothiole-2,7-diamine?
The IUPAC name of thieno[3,2-e][1]benzothiole-2,7-diamine (CID 69036958) is thieno[3,2-e][1]benzothiole-2,7-diamine.
What is the SMILES notation for thieno[3,2-e][1]benzothiole-2,7-diamine?
The canonical SMILES for thieno[3,2-e][1]benzothiole-2,7-diamine is Nc1cc2c(ccc3sc(N)cc32)s1.
What is the InChIKey of thieno[3,2-e][1]benzothiole-2,7-diamine?
The InChIKey is RRMBQOPOIKHNOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S2/c11-9-3-5-6-4-10(12)14-8(6)2-1-7(5)13-9/h1-4H,11-12H2.
What are the key properties of thieno[3,2-e][1]benzothiole-2,7-diamine?
thieno[3,2-e][1]benzothiole-2,7-diamine has a molecular weight of 220.32 g/mol, XLogP of 3.28, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-e][1]benzothiole-2,7-diamine is sourced from PubChem (CID 69036958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).