About 2-piperazin-1-yl-1H-1,3-diazepine
2-piperazin-1-yl-1H-1,3-diazepine (PubChem CID 69037173) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-piperazin-1-yl-1H-1,3-diazepine.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-1H-1,3-diazepine |
| PubChem CID | 69037173 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-piperazin-1-yl-1H-1,3-diazepine |
| SMILES | C1=CN=C(N2CCNCC2)NC=C1 |
| InChI | InChI=1S/C9H14N4/c1-2-4-12-9(11-3-1)13-7-5-10-6-8-13/h1-4,10H,5-8H2,(H,11,12) |
| InChIKey | NQWLLGPMDHJMEB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperazin-1-yl-1H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-1H-1,3-diazepine?
The IUPAC name of 2-piperazin-1-yl-1H-1,3-diazepine (CID 69037173) is 2-piperazin-1-yl-1H-1,3-diazepine.
What is the SMILES notation for 2-piperazin-1-yl-1H-1,3-diazepine?
The canonical SMILES for 2-piperazin-1-yl-1H-1,3-diazepine is C1=CN=C(N2CCNCC2)NC=C1.
What is the InChIKey of 2-piperazin-1-yl-1H-1,3-diazepine?
The InChIKey is NQWLLGPMDHJMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-2-4-12-9(11-3-1)13-7-5-10-6-8-13/h1-4,10H,5-8H2,(H,11,12).
What are the key properties of 2-piperazin-1-yl-1H-1,3-diazepine?
2-piperazin-1-yl-1H-1,3-diazepine has a molecular weight of 178.24 g/mol, XLogP of -0.12, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-1H-1,3-diazepine is sourced from PubChem (CID 69037173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).