About thieno[2,3-f][1]benzofuran-4-ol
thieno[2,3-f][1]benzofuran-4-ol (PubChem CID 69038113) has the molecular formula C10H6O2S
and a molecular weight of 190.22 g/mol. Its IUPAC name is thieno[2,3-f][1]benzofuran-4-ol.
Molecular Properties
| Compound Name | thieno[2,3-f][1]benzofuran-4-ol |
| PubChem CID | 69038113 |
| Molecular Formula | C10H6O2S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | thieno[2,3-f][1]benzofuran-4-ol |
| SMILES | Oc1c2ccoc2cc2ccsc12 |
| InChI | InChI=1S/C10H6O2S/c11-9-7-1-3-12-8(7)5-6-2-4-13-10(6)9/h1-5,11H |
| InChIKey | IJWFIBZAUMWVNP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[2,3-f][1]benzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-f][1]benzofuran-4-ol?
The IUPAC name of thieno[2,3-f][1]benzofuran-4-ol (CID 69038113) is thieno[2,3-f][1]benzofuran-4-ol.
What is the SMILES notation for thieno[2,3-f][1]benzofuran-4-ol?
The canonical SMILES for thieno[2,3-f][1]benzofuran-4-ol is Oc1c2ccoc2cc2ccsc12.
What is the InChIKey of thieno[2,3-f][1]benzofuran-4-ol?
The InChIKey is IJWFIBZAUMWVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2S/c11-9-7-1-3-12-8(7)5-6-2-4-13-10(6)9/h1-5,11H.
What are the key properties of thieno[2,3-f][1]benzofuran-4-ol?
thieno[2,3-f][1]benzofuran-4-ol has a molecular weight of 190.22 g/mol, XLogP of 3.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-f][1]benzofuran-4-ol is sourced from PubChem (CID 69038113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).