C34H41N5OS — CID 69038138
2-[1-[3-[5-[3-[(5-methylpyrazin-2-yl)methylamino]propyl]thiophen-2-yl]propyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 69038138) has the molecular formula C34H41N5OS and a molecular weight of 567.80 g/mol. Its IUPAC name is 2-[1-[3-[5-[3-[(5-methylpyrazin-2-yl)methylamino]propyl]thiophen-2-yl]propyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[1-[3-[5-[3-[(5-methylpyrazin-2-yl)methylamino]propyl]thiophen-2-yl]propyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 69038138 |
| Molecular Formula | C34H41N5OS |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 2-[1-[3-[5-[3-[(5-methylpyrazin-2-yl)methylamino]propyl]thiophen-2-yl]propyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | Cc1cnc(CNCCCc2ccc(CCCN3CCC(C(C(N)=O)(c4ccccc4)c4ccccc4)C3)s2)cn1 |
| InChI | InChI=1S/C34H41N5OS/c1-26-22-38-30(24-37-26)23-36-19-8-14-31-16-17-32(41-31)15-9-20-39-21-18-29(25-39)34(33(35)40,27-10-4-2-5-11-27)28-12-6-3-7-13-28/h2-7,10-13,16-17,22,24,29,36H,8-9,14-15,18-21,23,25H2,1H3,(H2,35,40) |
| InChIKey | FDKLMAPRKVXFJE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|