C18H30N4O3 — CID 69038360
4-[(3aR,7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-benzimidazol-1-yl]-1-piperidin-4-ylpiperidin-1-ium-1-carboxylate (PubChem CID 69038360) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-[(3aR,7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-benzimidazol-1-yl]-1-piperidin-4-ylpiperidin-1-ium-1-carboxylate.
| Compound Name | 4-[(3aR,7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-benzimidazol-1-yl]-1-piperidin-4-ylpiperidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 69038360 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 4-[(3aR,7aR)-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-benzimidazol-1-yl]-1-piperidin-4-ylpiperidin-1-ium-1-carboxylate |
| SMILES | O=C1N[C@@H]2CCCC[C@H]2N1C1CC[N+](C(=O)[O-])(C2CCNCC2)CC1 |
| InChI | InChI=1S/C18H30N4O3/c23-17-20-15-3-1-2-4-16(15)21(17)13-7-11-22(12-8-13,18(24)25)14-5-9-19-10-6-14/h13-16,19H,1-12H2,(H-,20,23,24,25)/t13?,15-,16-,22?/m1/s1 |
| InChIKey | KDIYXIBKXLWRPG-FEESSWGRSA-N |
| XLogP | 0.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|