About (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride
(2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride (PubChem CID 69038375) has the molecular formula C12H17ClF3NO2
and a molecular weight of 299.72 g/mol. Its IUPAC name is (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride.
Molecular Properties
| Compound Name | (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride |
| PubChem CID | 69038375 |
| Molecular Formula | C12H17ClF3NO2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride |
| SMILES | CN[C@@H](C)Cc1ccccc1.Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H15N.C2HF3O2.ClH/c1-9(11-2)8-10-6-4-3-5-7-10;3-2(4,5)1(6)7;/h3-7,9,11H,8H2,1-2H3;(H,6,7);1H/t9-;;/m0../s1 |
| InChIKey | YTLKLNIJCPFZGD-WWPIYYJJSA-N |
| XLogP | 2.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride?
The IUPAC name of (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride (CID 69038375) is (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride.
What is the SMILES notation for (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride?
The canonical SMILES for (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride is CN[C@@H](C)Cc1ccccc1.Cl.O=C(O)C(F)(F)F.
What is the InChIKey of (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride?
The InChIKey is YTLKLNIJCPFZGD-WWPIYYJJSA-N. The full InChI is InChI=1S/C10H15N.C2HF3O2.ClH/c1-9(11-2)8-10-6-4-3-5-7-10;3-2(4,5)1(6)7;/h3-7,9,11H,8H2,1-2H3;(H,6,7);1H/t9-;;/m0../s1.
What are the key properties of (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride?
(2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride has a molecular weight of 299.72 g/mol, XLogP of 2.89, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-methyl-1-phenylpropan-2-amine;2,2,2-trifluoroacetic acid;hydrochloride is sourced from PubChem (CID 69038375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).