About 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one
7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 69039045) has the molecular formula C13H19N3O3S
and a molecular weight of 297.38 g/mol. Its IUPAC name is 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 69039045 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC[C@H](C)N1C(=O)C(C)(C)c2cnc(S(C)(=O)=O)nc21 |
| InChI | InChI=1S/C13H19N3O3S/c1-6-8(2)16-10-9(13(3,4)11(16)17)7-14-12(15-10)20(5,18)19/h7-8H,6H2,1-5H3/t8-/m0/s1 |
| InChIKey | GUEZPYOVPYERTQ-QMMMGPOBSA-N |
| XLogP | 1.30 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one (CID 69039045) is 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one is CC[C@H](C)N1C(=O)C(C)(C)c2cnc(S(C)(=O)=O)nc21.
What is the InChIKey of 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is GUEZPYOVPYERTQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H19N3O3S/c1-6-8(2)16-10-9(13(3,4)11(16)17)7-14-12(15-10)20(5,18)19/h7-8H,6H2,1-5H3/t8-/m0/s1.
What are the key properties of 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one?
7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 297.38 g/mol, XLogP of 1.30, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2S)-butan-2-yl]-5,5-dimethyl-2-methylsulfonylpyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 69039045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).