About 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one
5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one (PubChem CID 69039120) has the molecular formula C19H18O2
and a molecular weight of 278.35 g/mol. Its IUPAC name is 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one.
Molecular Properties
| Compound Name | 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one |
| PubChem CID | 69039120 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one |
| SMILES | CC(=O)c1cccc(-c2ccc3c(c2)C(C)(C)CC3=O)c1 |
| InChI | InChI=1S/C19H18O2/c1-12(20)13-5-4-6-14(9-13)15-7-8-16-17(10-15)19(2,3)11-18(16)21/h4-10H,11H2,1-3H3 |
| InChIKey | RPNDGUOLPLPJJT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one?
The IUPAC name of 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one (CID 69039120) is 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one.
What is the SMILES notation for 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one?
The canonical SMILES for 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one is CC(=O)c1cccc(-c2ccc3c(c2)C(C)(C)CC3=O)c1.
What is the InChIKey of 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one?
The InChIKey is RPNDGUOLPLPJJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O2/c1-12(20)13-5-4-6-14(9-13)15-7-8-16-17(10-15)19(2,3)11-18(16)21/h4-10H,11H2,1-3H3.
What are the key properties of 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one?
5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one has a molecular weight of 278.35 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-acetylphenyl)-3,3-dimethyl-2H-inden-1-one is sourced from PubChem (CID 69039120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).