C15H23BN2O6S — CID 69040161
(2-methylpropan-2-yl)oxycarbonyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 69040161) has the molecular formula C15H23BN2O6S and a molecular weight of 370.24 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69040161 |
| Molecular Formula | C15H23BN2O6S |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)O)c1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C15H23BN2O6S/c1-13(2,3)22-12(21)18(11(19)20)10-17-8-9(25-10)16-23-14(4,5)15(6,7)24-16/h8H,1-7H3,(H,19,20) |
| InChIKey | HUJMLMKWSDDIJP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|