About ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate
ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate (PubChem CID 69040453) has the molecular formula C25H27F2N3O3
and a molecular weight of 455.51 g/mol. Its IUPAC name is ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate |
| PubChem CID | 69040453 |
| Molecular Formula | C25H27F2N3O3 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(OC)c(C3CCN(C)CC3)cc2c1Nc1ccc(F)cc1F |
| InChI | InChI=1S/C25H27F2N3O3/c1-4-33-25(31)19-14-28-22-13-23(32-3)17(15-7-9-30(2)10-8-15)12-18(22)24(19)29-21-6-5-16(26)11-20(21)27/h5-6,11-15H,4,7-10H2,1-3H3,(H,28,29) |
| InChIKey | QNIVSZAFXQGBLQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate?
The IUPAC name of ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate (CID 69040453) is ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate.
What is the SMILES notation for ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate?
The canonical SMILES for ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate is CCOC(=O)c1cnc2cc(OC)c(C3CCN(C)CC3)cc2c1Nc1ccc(F)cc1F.
What is the InChIKey of ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate?
The InChIKey is QNIVSZAFXQGBLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27F2N3O3/c1-4-33-25(31)19-14-28-22-13-23(32-3)17(15-7-9-30(2)10-8-15)12-18(22)24(19)29-21-6-5-16(26)11-20(21)27/h5-6,11-15H,4,7-10H2,1-3H3,(H,28,29).
What are the key properties of ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate?
ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate has a molecular weight of 455.51 g/mol, XLogP of 5.25, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,4-difluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)quinoline-3-carboxylate is sourced from PubChem (CID 69040453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).