C30H41NO2 — CID 69040550
2-(diethylamino)ethyl 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate (PubChem CID 69040550) has the molecular formula C30H41NO2 and a molecular weight of 447.66 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate |
|---|---|
| PubChem CID | 69040550 |
| Molecular Formula | C30H41NO2 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(C=Cc2cc3c(cc2C)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C30H41NO2/c1-8-31(9-2)18-19-33-28(32)24-13-10-23(11-14-24)12-15-25-21-27-26(20-22(25)3)29(4,5)16-17-30(27,6)7/h10-15,20-21H,8-9,16-19H2,1-7H3 |
| InChIKey | YDZKAFPBIONLDX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|