C13H20O4 — CID 69040622
(E)-2-methyl-4,4-bis(oxolan-3-yl)but-2-enoic acid (PubChem CID 69040622) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (E)-2-methyl-4,4-bis(oxolan-3-yl)but-2-enoic acid.
| Compound Name | (E)-2-methyl-4,4-bis(oxolan-3-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 69040622 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (E)-2-methyl-4,4-bis(oxolan-3-yl)but-2-enoic acid |
| SMILES | C/C(=C\C(C1CCOC1)C1CCOC1)C(=O)O |
| InChI | InChI=1S/C13H20O4/c1-9(13(14)15)6-12(10-2-4-16-7-10)11-3-5-17-8-11/h6,10-12H,2-5,7-8H2,1H3,(H,14,15)/b9-6+ |
| InChIKey | XWTBNGWJOSITDY-RMKNXTFCSA-N |
| XLogP | 1.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|