About 8H-furo[3,2-g]indol-4-amine
8H-furo[3,2-g]indol-4-amine (PubChem CID 69040704) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 8H-furo[3,2-g]indol-4-amine.
Molecular Properties
| Compound Name | 8H-furo[3,2-g]indol-4-amine |
| PubChem CID | 69040704 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 8H-furo[3,2-g]indol-4-amine |
| SMILES | Nc1cc2cc[nH]c2c2occc12 |
| InChI | InChI=1S/C10H8N2O/c11-8-5-6-1-3-12-9(6)10-7(8)2-4-13-10/h1-5,12H,11H2 |
| InChIKey | ZMPZISFKRFHTGS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8H-furo[3,2-g]indol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-furo[3,2-g]indol-4-amine?
The IUPAC name of 8H-furo[3,2-g]indol-4-amine (CID 69040704) is 8H-furo[3,2-g]indol-4-amine.
What is the SMILES notation for 8H-furo[3,2-g]indol-4-amine?
The canonical SMILES for 8H-furo[3,2-g]indol-4-amine is Nc1cc2cc[nH]c2c2occc12.
What is the InChIKey of 8H-furo[3,2-g]indol-4-amine?
The InChIKey is ZMPZISFKRFHTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c11-8-5-6-1-3-12-9(6)10-7(8)2-4-13-10/h1-5,12H,11H2.
What are the key properties of 8H-furo[3,2-g]indol-4-amine?
8H-furo[3,2-g]indol-4-amine has a molecular weight of 172.19 g/mol, XLogP of 2.50, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-furo[3,2-g]indol-4-amine is sourced from PubChem (CID 69040704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).