About 3,6-dimethyl-8H-furo[3,2-g]indole
3,6-dimethyl-8H-furo[3,2-g]indole (PubChem CID 69040926) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 3,6-dimethyl-8H-furo[3,2-g]indole.
Molecular Properties
| Compound Name | 3,6-dimethyl-8H-furo[3,2-g]indole |
| PubChem CID | 69040926 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 3,6-dimethyl-8H-furo[3,2-g]indole |
| SMILES | Cc1c[nH]c2c1ccc1c(C)coc12 |
| InChI | InChI=1S/C12H11NO/c1-7-5-13-11-9(7)3-4-10-8(2)6-14-12(10)11/h3-6,13H,1-2H3 |
| InChIKey | LXXYNWZOYQSIRS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-dimethyl-8H-furo[3,2-g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-8H-furo[3,2-g]indole?
The IUPAC name of 3,6-dimethyl-8H-furo[3,2-g]indole (CID 69040926) is 3,6-dimethyl-8H-furo[3,2-g]indole.
What is the SMILES notation for 3,6-dimethyl-8H-furo[3,2-g]indole?
The canonical SMILES for 3,6-dimethyl-8H-furo[3,2-g]indole is Cc1c[nH]c2c1ccc1c(C)coc12.
What is the InChIKey of 3,6-dimethyl-8H-furo[3,2-g]indole?
The InChIKey is LXXYNWZOYQSIRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-7-5-13-11-9(7)3-4-10-8(2)6-14-12(10)11/h3-6,13H,1-2H3.
What are the key properties of 3,6-dimethyl-8H-furo[3,2-g]indole?
3,6-dimethyl-8H-furo[3,2-g]indole has a molecular weight of 185.23 g/mol, XLogP of 3.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-8H-furo[3,2-g]indole is sourced from PubChem (CID 69040926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).