C18H25F3N6O3 — CID 69041113
4-methyl-1-[1-(nitromethyl)-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexyl]pyrrolidin-2-one (PubChem CID 69041113) has the molecular formula C18H25F3N6O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 4-methyl-1-[1-(nitromethyl)-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexyl]pyrrolidin-2-one.
| Compound Name | 4-methyl-1-[1-(nitromethyl)-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 69041113 |
| Molecular Formula | C18H25F3N6O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-methyl-1-[1-(nitromethyl)-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexyl]pyrrolidin-2-one |
| SMILES | CC1CC(=O)N(C2(C[N+](=O)[O-])CCC(N3CCn4c(nnc4C(F)(F)F)C3)CC2)C1 |
| InChI | InChI=1S/C18H25F3N6O3/c1-12-8-15(28)26(9-12)17(11-27(29)30)4-2-13(3-5-17)24-6-7-25-14(10-24)22-23-16(25)18(19,20)21/h12-13H,2-11H2,1H3 |
| InChIKey | XMXCBWUDIPOQPE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|