About butanamide;pyrrole-2,5-dione
butanamide;pyrrole-2,5-dione (PubChem CID 69042971) has the molecular formula C8H12N2O3
and a molecular weight of 184.20 g/mol. Its IUPAC name is butanamide;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | butanamide;pyrrole-2,5-dione |
| PubChem CID | 69042971 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | butanamide;pyrrole-2,5-dione |
| SMILES | CCCC(N)=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C4H9NO/c6-3-1-2-4(7)5-3;1-2-3-4(5)6/h1-2H,(H,5,6,7);2-3H2,1H3,(H2,5,6) |
| InChIKey | MYWYJEJXTHGQII-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze butanamide;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;pyrrole-2,5-dione?
The IUPAC name of butanamide;pyrrole-2,5-dione (CID 69042971) is butanamide;pyrrole-2,5-dione.
What is the SMILES notation for butanamide;pyrrole-2,5-dione?
The canonical SMILES for butanamide;pyrrole-2,5-dione is CCCC(N)=O.O=C1C=CC(=O)N1.
What is the InChIKey of butanamide;pyrrole-2,5-dione?
The InChIKey is MYWYJEJXTHGQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.C4H9NO/c6-3-1-2-4(7)5-3;1-2-3-4(5)6/h1-2H,(H,5,6,7);2-3H2,1H3,(H2,5,6).
What are the key properties of butanamide;pyrrole-2,5-dione?
butanamide;pyrrole-2,5-dione has a molecular weight of 184.20 g/mol, XLogP of -0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;pyrrole-2,5-dione is sourced from PubChem (CID 69042971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).