About 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide
6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide (PubChem CID 69043158) has the molecular formula C14H13Cl2FN4O2
and a molecular weight of 359.19 g/mol. Its IUPAC name is 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide |
| PubChem CID | 69043158 |
| Molecular Formula | C14H13Cl2FN4O2 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide |
| SMILES | CNC(=O)c1cc(OCCc2c(Cl)ccc(F)c2Cl)c(N)nn1 |
| InChI | InChI=1S/C14H13Cl2FN4O2/c1-19-14(22)10-6-11(13(18)21-20-10)23-5-4-7-8(15)2-3-9(17)12(7)16/h2-3,6H,4-5H2,1H3,(H2,18,21)(H,19,22) |
| InChIKey | LKESVOGOISPQIL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide?
The IUPAC name of 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide (CID 69043158) is 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide.
What is the SMILES notation for 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide?
The canonical SMILES for 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide is CNC(=O)c1cc(OCCc2c(Cl)ccc(F)c2Cl)c(N)nn1.
What is the InChIKey of 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide?
The InChIKey is LKESVOGOISPQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2FN4O2/c1-19-14(22)10-6-11(13(18)21-20-10)23-5-4-7-8(15)2-3-9(17)12(7)16/h2-3,6H,4-5H2,1H3,(H2,18,21)(H,19,22).
What are the key properties of 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide?
6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide has a molecular weight of 359.19 g/mol, XLogP of 2.49, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-[2-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide is sourced from PubChem (CID 69043158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).