C20H29F3O2 — CID 69043721
(8R,9R,10R,13S,14S)-10,13-dimethyl-17-(trifluoromethyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 69043721) has the molecular formula C20H29F3O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-17-(trifluoromethyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-17-(trifluoromethyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 69043721 |
| Molecular Formula | C20H29F3O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-17-(trifluoromethyl)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CCC(O)CC1=CC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(O)C(F)(F)F |
| InChI | InChI=1S/C20H29F3O2/c1-17-8-5-13(24)11-12(17)3-4-14-15(17)6-9-18(2)16(14)7-10-19(18,25)20(21,22)23/h3,13-16,24-25H,4-11H2,1-2H3/t13?,14-,15-,16+,17+,18+,19?/m1/s1 |
| InChIKey | CJMBUXKNUUGOEU-NMELGNCPSA-N |
| XLogP | 4.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|