C8H11F3N4 — CID 69043729
7-ethyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 69043729) has the molecular formula C8H11F3N4 and a molecular weight of 220.20 g/mol. Its IUPAC name is 7-ethyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 7-ethyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 69043729 |
| Molecular Formula | C8H11F3N4 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 7-ethyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | CCC1Cc2nnc(C(F)(F)F)n2CN1 |
| InChI | InChI=1S/C8H11F3N4/c1-2-5-3-6-13-14-7(8(9,10)11)15(6)4-12-5/h5,12H,2-4H2,1H3 |
| InChIKey | RBMYAWWEJVZFGP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |