About butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid
butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 69043741) has the molecular formula C17H24F3NO4
and a molecular weight of 363.38 g/mol. Its IUPAC name is butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
| PubChem CID | 69043741 |
| Molecular Formula | C17H24F3NO4 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | CCC(C)O.CCC(C)Oc1nc(C(F)(F)F)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C13H14F3NO3.C4H10O/c1-3-8(2)20-12-9(5-7-11(18)19)4-6-10(17-12)13(14,15)16;1-3-4(2)5/h4-8H,3H2,1-2H3,(H,18,19);4-5H,3H2,1-2H3/b7-5+; |
| InChIKey | LGCJTUKKKSHDIL-GZOLSCHFSA-N |
| XLogP | 4.15 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid?
The IUPAC name of butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid (CID 69043741) is butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid.
What is the SMILES notation for butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid?
The canonical SMILES for butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid is CCC(C)O.CCC(C)Oc1nc(C(F)(F)F)ccc1/C=C/C(=O)O.
What is the InChIKey of butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid?
The InChIKey is LGCJTUKKKSHDIL-GZOLSCHFSA-N. The full InChI is InChI=1S/C13H14F3NO3.C4H10O/c1-3-8(2)20-12-9(5-7-11(18)19)4-6-10(17-12)13(14,15)16;1-3-4(2)5/h4-8H,3H2,1-2H3,(H,18,19);4-5H,3H2,1-2H3/b7-5+;.
What are the key properties of butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid?
butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid has a molecular weight of 363.38 g/mol, XLogP of 4.15, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;(E)-3-[2-butan-2-yloxy-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid is sourced from PubChem (CID 69043741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).