About 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine
2,5-dimethylpyrazine;2,3,5-trimethylpyrazine (PubChem CID 69044023) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine.
Molecular Properties
| Compound Name | 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine |
| PubChem CID | 69044023 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine |
| SMILES | Cc1cnc(C)c(C)n1.Cc1cnc(C)cn1 |
| InChI | InChI=1S/C7H10N2.C6H8N2/c1-5-4-8-6(2)7(3)9-5;1-5-3-8-6(2)4-7-5/h4H,1-3H3;3-4H,1-2H3 |
| InChIKey | WRYOSUWOJDWVFW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine?
The IUPAC name of 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine (CID 69044023) is 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine.
What is the SMILES notation for 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine?
The canonical SMILES for 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine is Cc1cnc(C)c(C)n1.Cc1cnc(C)cn1.
What is the InChIKey of 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine?
The InChIKey is WRYOSUWOJDWVFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C6H8N2/c1-5-4-8-6(2)7(3)9-5;1-5-3-8-6(2)4-7-5/h4H,1-3H3;3-4H,1-2H3.
What are the key properties of 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine?
2,5-dimethylpyrazine;2,3,5-trimethylpyrazine has a molecular weight of 230.31 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylpyrazine;2,3,5-trimethylpyrazine is sourced from PubChem (CID 69044023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).